 molecular composition
molecular composition
Molecular formula:
CH2=CHCH2O(CH2CH2O)n(CH2CH(CH3)O)mOCCH3
performance
- 1、KLF-A series is an allyl polyalkoxymethyl ether terminated product independently developed by Cologne. 
- 2、Because the terminal hydroxyl active hydrogen is replaced by methyl group for silylhydrogenation reaction, the reaction between hydroxyl group and silyl hydrogen bond is eliminated, which effectively reduces the viscosity of the product and increases the effective content, and improves the quality of polyether-modified silicone oil. 

 
                            